C16H13F3N4O5S — CID 18927074
N-(diaminomethylidene)-2-methyl-5-nitro-4-[3-(trifluoromethyl)phenyl]sulfonylbenzamide (PubChem CID 18927074) has the molecular formula C16H13F3N4O5S and a molecular weight of 430.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-5-nitro-4-[3-(trifluoromethyl)phenyl]sulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-methyl-5-nitro-4-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 18927074 |
| Molecular Formula | C16H13F3N4O5S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-5-nitro-4-[3-(trifluoromethyl)phenyl]sulfonylbenzamide |
| SMILES | Cc1cc(S(=O)(=O)c2cccc(C(F)(F)F)c2)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H13F3N4O5S/c1-8-5-13(12(23(25)26)7-11(8)14(24)22-15(20)21)29(27,28)10-4-2-3-9(6-10)16(17,18)19/h2-7H,1H3,(H4,20,21,22,24) |
| InChIKey | JLIBTDDYXJOZHK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|