C14H8Cl2F3NO4S — CID 2799609
1,5-dichloro-2-methyl-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylbenzene (PubChem CID 2799609) has the molecular formula C14H8Cl2F3NO4S and a molecular weight of 414.19 g/mol. Its IUPAC name is 1,5-dichloro-2-methyl-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylbenzene.
| Compound Name | 1,5-dichloro-2-methyl-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 2799609 |
| Molecular Formula | C14H8Cl2F3NO4S |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 1,5-dichloro-2-methyl-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylbenzene |
| SMILES | Cc1cc(S(=O)(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl2F3NO4S/c1-7-4-13(10(16)6-9(7)15)25(23,24)12-3-2-8(14(17,18)19)5-11(12)20(21)22/h2-6H,1H3 |
| InChIKey | IQPFZKDZRHIIMS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|