C13H10F3N3O4S — CID 134100715
4,6-dimethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpyrimidine (PubChem CID 134100715) has the molecular formula C13H10F3N3O4S and a molecular weight of 361.30 g/mol. Its IUPAC name is 4,6-dimethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpyrimidine.
| Compound Name | 4,6-dimethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpyrimidine |
|---|---|
| PubChem CID | 134100715 |
| Molecular Formula | C13H10F3N3O4S |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 4,6-dimethyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfonylpyrimidine |
| SMILES | Cc1cc(C)nc(S(=O)(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H10F3N3O4S/c1-7-5-8(2)18-12(17-7)24(22,23)11-4-3-9(13(14,15)16)6-10(11)19(20)21/h3-6H,1-2H3 |
| InChIKey | OXIUEMZWVYFKEI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|