C11H11F3N2O7S — CID 102251134
(2S,3R)-3-hydroxy-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 102251134) has the molecular formula C11H11F3N2O7S and a molecular weight of 372.28 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 102251134 |
| Molecular Formula | C11H11F3N2O7S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H11F3N2O7S/c1-5(17)9(10(18)19)15-24(22,23)8-3-2-6(11(12,13)14)4-7(8)16(20)21/h2-5,9,15,17H,1H3,(H,18,19)/t5-,9+/m1/s1 |
| InChIKey | ZALXPAYTTWTAMK-ANLVUFKYSA-N |
| XLogP | 0.73 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|