C10H11FN2O7S — CID 104965162
(2S,3R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]-3-hydroxybutanoic acid (PubChem CID 104965162) has the molecular formula C10H11FN2O7S and a molecular weight of 322.27 g/mol. Its IUPAC name is (2S,3R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104965162 |
| Molecular Formula | C10H11FN2O7S |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (2S,3R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NS(=O)(=O)c1cc([N+](=O)[O-])ccc1F)C(=O)O |
| InChI | InChI=1S/C10H11FN2O7S/c1-5(14)9(10(15)16)12-21(19,20)8-4-6(13(17)18)2-3-7(8)11/h2-5,9,12,14H,1H3,(H,15,16)/t5-,9+/m1/s1 |
| InChIKey | YSHNPAMESFOWAI-ANLVUFKYSA-N |
| XLogP | -0.15 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|