C9H9FN2O6S — CID 54991572
(2R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 54991572) has the molecular formula C9H9FN2O6S and a molecular weight of 292.24 g/mol. Its IUPAC name is (2R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 54991572 |
| Molecular Formula | C9H9FN2O6S |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (2R)-2-[(2-fluoro-5-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1cc([N+](=O)[O-])ccc1F)C(=O)O |
| InChI | InChI=1S/C9H9FN2O6S/c1-5(9(13)14)11-19(17,18)8-4-6(12(15)16)2-3-7(8)10/h2-5,11H,1H3,(H,13,14)/t5-/m1/s1 |
| InChIKey | MYTAVIQNKKMUQC-RXMQYKEDSA-N |
| XLogP | 0.49 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|