C11H13FN2O6S — CID 80537671
4-[(2-fluoro-5-nitrophenyl)sulfonylamino]-2-methylbutanoic acid (PubChem CID 80537671) has the molecular formula C11H13FN2O6S and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-[(2-fluoro-5-nitrophenyl)sulfonylamino]-2-methylbutanoic acid.
| Compound Name | 4-[(2-fluoro-5-nitrophenyl)sulfonylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80537671 |
| Molecular Formula | C11H13FN2O6S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-[(2-fluoro-5-nitrophenyl)sulfonylamino]-2-methylbutanoic acid |
| SMILES | CC(CCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1F)C(=O)O |
| InChI | InChI=1S/C11H13FN2O6S/c1-7(11(15)16)4-5-13-21(19,20)10-6-8(14(17)18)2-3-9(10)12/h2-3,6-7,13H,4-5H2,1H3,(H,15,16) |
| InChIKey | GSDUZPFYRBDOPY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|