C10H14FN3O5S — CID 64539787
N-(2-amino-3-hydroxybutyl)-2-fluoro-5-nitrobenzenesulfonamide (PubChem CID 64539787) has the molecular formula C10H14FN3O5S and a molecular weight of 307.30 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-2-fluoro-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-2-fluoro-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64539787 |
| Molecular Formula | C10H14FN3O5S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-2-fluoro-5-nitrobenzenesulfonamide |
| SMILES | CC(O)C(N)CNS(=O)(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C10H14FN3O5S/c1-6(15)9(12)5-13-20(18,19)10-4-7(14(16)17)2-3-8(10)11/h2-4,6,9,13,15H,5,12H2,1H3 |
| InChIKey | QKNRRCYOZZUMBG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|