C10H11F3N2O5S — CID 103834036
2-methyl-5-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide (PubChem CID 103834036) has the molecular formula C10H11F3N2O5S and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103834036 |
| Molecular Formula | C10H11F3N2O5S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-methyl-5-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O5S/c1-6-2-3-7(15(17)18)4-8(6)21(19,20)14-5-9(16)10(11,12)13/h2-4,9,14,16H,5H2,1H3 |
| InChIKey | JKCJIFNLEVRDSS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|