C9H9F3N2O5S — CID 103834025
2-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide (PubChem CID 103834025) has the molecular formula C9H9F3N2O5S and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide.
| Compound Name | 2-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103834025 |
| Molecular Formula | C9H9F3N2O5S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-nitro-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O5S/c10-9(11,12)8(15)5-13-20(18,19)7-4-2-1-3-6(7)14(16)17/h1-4,8,13,15H,5H2 |
| InChIKey | XBYCTHDWHQDXOH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|