C16H18N2O7S — CID 90613499
N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2-nitrobenzenesulfonamide (PubChem CID 90613499) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90613499 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(C(O)CNS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H18N2O7S/c1-24-14-8-7-11(9-15(14)25-2)13(19)10-17-26(22,23)16-6-4-3-5-12(16)18(20)21/h3-9,13,17,19H,10H2,1-2H3 |
| InChIKey | RZUPRPBCUROIBE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|