C20H25N3O7S — CID 637135
(2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(2-nitrophenyl)sulfonylamino]butanamide (PubChem CID 637135) has the molecular formula C20H25N3O7S and a molecular weight of 451.50 g/mol. Its IUPAC name is (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(2-nitrophenyl)sulfonylamino]butanamide.
| Compound Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(2-nitrophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 637135 |
| Molecular Formula | C20H25N3O7S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (2R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(2-nitrophenyl)sulfonylamino]butanamide |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O7S/c1-4-15(22-31(27,28)19-8-6-5-7-16(19)23(25)26)20(24)21-12-11-14-9-10-17(29-2)18(13-14)30-3/h5-10,13,15,22H,4,11-12H2,1-3H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | KLVDXOPDLRJZBC-OAHLLOKOSA-N |
| XLogP | 2.03 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|