C24H25N3O7S — CID 25131825
methyl (2S)-3-naphthalen-2-yl-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]butanoyl]amino]propanoate (PubChem CID 25131825) has the molecular formula C24H25N3O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is methyl (2S)-3-naphthalen-2-yl-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]butanoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-naphthalen-2-yl-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 25131825 |
| Molecular Formula | C24H25N3O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | methyl (2S)-3-naphthalen-2-yl-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]butanoyl]amino]propanoate |
| SMILES | CC[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)OC |
| InChI | InChI=1S/C24H25N3O7S/c1-3-19(26-35(32,33)22-11-7-6-10-21(22)27(30)31)23(28)25-20(24(29)34-2)15-16-12-13-17-8-4-5-9-18(17)14-16/h4-14,19-20,26H,3,15H2,1-2H3,(H,25,28)/t19-,20-/m0/s1 |
| InChIKey | SHOAEUQBDHXEPY-PMACEKPBSA-N |
| XLogP | 2.71 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|