C16H18N2O6S — CID 177405776
N-[(2R)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 177405776) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 177405776 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | COc1ccc(C[C@H](CO)NS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O6S/c1-24-14-8-6-12(7-9-14)10-13(11-19)17-25(22,23)16-5-3-2-4-15(16)18(20)21/h2-9,13,17,19H,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | BXTQGGYKRPUKRY-CYBMUJFWSA-N |
| XLogP | 1.49 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|