C12H14N2O6S — CID 53253357
N-[(2R,3S)-1,3-dihydroxy-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 53253357) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is N-[(2R,3S)-1,3-dihydroxy-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2R,3S)-1,3-dihydroxy-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 53253357 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[(2R,3S)-1,3-dihydroxy-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | C#C[C@](C)(O)[C@@H](CO)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O6S/c1-3-12(2,16)11(8-15)13-21(19,20)10-7-5-4-6-9(10)14(17)18/h1,4-7,11,13,15-16H,8H2,2H3/t11-,12+/m1/s1 |
| InChIKey | STKBXTYXLHGYLR-NEPJUHHUSA-N |
| XLogP | -0.38 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|