C24H33N3O6SSi — CID 102047336
N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyanilino)-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 102047336) has the molecular formula C24H33N3O6SSi and a molecular weight of 519.70 g/mol. Its IUPAC name is N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyanilino)-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyanilino)-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102047336 |
| Molecular Formula | C24H33N3O6SSi |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyanilino)-3-methylpent-4-yn-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | C#C[C@@](C)(Nc1ccc(O)cc1)[C@@H](CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H33N3O6SSi/c1-8-24(5,25-18-13-15-19(28)16-14-18)22(17-33-35(6,7)23(2,3)4)26-34(31,32)21-12-10-9-11-20(21)27(29)30/h1,9-16,22,25-26,28H,17H2,2-7H3/t22-,24-/m1/s1 |
| InChIKey | ZCOTTZLFRQHYGA-ISKFKSNPSA-N |
| XLogP | 4.47 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|