C17H27N3O6S — CID 67542806
(2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoic acid (PubChem CID 67542806) has the molecular formula C17H27N3O6S and a molecular weight of 401.49 g/mol. Its IUPAC name is (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoic acid.
| Compound Name | (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoic acid |
|---|---|
| PubChem CID | 67542806 |
| Molecular Formula | C17H27N3O6S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S)-10-(methylamino)-2-[(2-nitrophenyl)sulfonylamino]decanoic acid |
| SMILES | CNCCCCCCCC[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H27N3O6S/c1-18-13-9-5-3-2-4-6-10-14(17(21)22)19-27(25,26)16-12-8-7-11-15(16)20(23)24/h7-8,11-12,14,18-19H,2-6,9-10,13H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | LJYCFBIFOPLWME-AWEZNQCLSA-N |
| XLogP | 2.28 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|