C13H18N2O7S — CID 102051131
[(4R)-5-hydroxy-4-[(2-nitrophenyl)sulfonylamino]pentyl] acetate (PubChem CID 102051131) has the molecular formula C13H18N2O7S and a molecular weight of 346.36 g/mol. Its IUPAC name is [(4R)-5-hydroxy-4-[(2-nitrophenyl)sulfonylamino]pentyl] acetate.
| Compound Name | [(4R)-5-hydroxy-4-[(2-nitrophenyl)sulfonylamino]pentyl] acetate |
|---|---|
| PubChem CID | 102051131 |
| Molecular Formula | C13H18N2O7S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(4R)-5-hydroxy-4-[(2-nitrophenyl)sulfonylamino]pentyl] acetate |
| SMILES | CC(=O)OCCC[C@H](CO)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N2O7S/c1-10(17)22-8-4-5-11(9-16)14-23(20,21)13-7-3-2-6-12(13)15(18)19/h2-3,6-7,11,14,16H,4-5,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | NFXWJFCFDKWPLI-LLVKDONJSA-N |
| XLogP | 0.58 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|