C18H26N2O7S — CID 102195203
[(4R)-4-(3-hydroxypropyl)-4-[(2-nitrophenyl)sulfonylamino]hept-6-enyl] acetate (PubChem CID 102195203) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is [(4R)-4-(3-hydroxypropyl)-4-[(2-nitrophenyl)sulfonylamino]hept-6-enyl] acetate.
| Compound Name | [(4R)-4-(3-hydroxypropyl)-4-[(2-nitrophenyl)sulfonylamino]hept-6-enyl] acetate |
|---|---|
| PubChem CID | 102195203 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(4R)-4-(3-hydroxypropyl)-4-[(2-nitrophenyl)sulfonylamino]hept-6-enyl] acetate |
| SMILES | C=CC[C@@](CCCO)(CCCOC(C)=O)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N2O7S/c1-3-10-18(11-6-13-21,12-7-14-27-15(2)22)19-28(25,26)17-9-5-4-8-16(17)20(23)24/h3-5,8-9,19,21H,1,6-7,10-14H2,2H3/t18-/m1/s1 |
| InChIKey | BCKVNADLLRVOGH-GOSISDBHSA-N |
| XLogP | 2.30 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|