C13H21N3O5S — CID 122202507
N-[(2R)-1-(4-hydroxybutylamino)propan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 122202507) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[(2R)-1-(4-hydroxybutylamino)propan-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-1-(4-hydroxybutylamino)propan-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122202507 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[(2R)-1-(4-hydroxybutylamino)propan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | C[C@H](CNCCCCO)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O5S/c1-11(10-14-8-4-5-9-17)15-22(20,21)13-7-3-2-6-12(13)16(18)19/h2-3,6-7,11,14-15,17H,4-5,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | TXWRTUZWOOEXEH-LLVKDONJSA-N |
| XLogP | 0.62 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|