C21H28N2O8S — CID 135080136
dimethyl 2-[4-[(2-nitrophenyl)sulfonyl-prop-2-enylamino]butyl]-2-prop-2-enylpropanedioate (PubChem CID 135080136) has the molecular formula C21H28N2O8S and a molecular weight of 468.53 g/mol. Its IUPAC name is dimethyl 2-[4-[(2-nitrophenyl)sulfonyl-prop-2-enylamino]butyl]-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-[4-[(2-nitrophenyl)sulfonyl-prop-2-enylamino]butyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 135080136 |
| Molecular Formula | C21H28N2O8S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | dimethyl 2-[4-[(2-nitrophenyl)sulfonyl-prop-2-enylamino]butyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCN(CCCCC(CC=C)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N2O8S/c1-5-13-21(19(24)30-3,20(25)31-4)14-9-10-16-22(15-6-2)32(28,29)18-12-8-7-11-17(18)23(26)27/h5-8,11-12H,1-2,9-10,13-16H2,3-4H3 |
| InChIKey | POYIGVJWDDLWDL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|