C19H26N2O8S — CID 21080146
(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2-nitrophenyl)sulfonyl-pent-4-enylamino]methyl]-3-oxopropanoic acid (PubChem CID 21080146) has the molecular formula C19H26N2O8S and a molecular weight of 442.49 g/mol. Its IUPAC name is (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2-nitrophenyl)sulfonyl-pent-4-enylamino]methyl]-3-oxopropanoic acid.
| Compound Name | (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2-nitrophenyl)sulfonyl-pent-4-enylamino]methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21080146 |
| Molecular Formula | C19H26N2O8S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[[(2-nitrophenyl)sulfonyl-pent-4-enylamino]methyl]-3-oxopropanoic acid |
| SMILES | C=CCCCN(C[C@@H](C(=O)O)C(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N2O8S/c1-5-6-9-12-20(13-14(17(22)23)18(24)29-19(2,3)4)30(27,28)16-11-8-7-10-15(16)21(25)26/h5,7-8,10-11,14H,1,6,9,12-13H2,2-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | CONNHVMPKSPHQS-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|