C20H30BrN3O8S — CID 59537069
tert-butyl (2S)-2-[[(2S)-2-[4-bromobutyl-(2-nitrophenyl)sulfonylamino]propanoyl]oxyamino]propanoate (PubChem CID 59537069) has the molecular formula C20H30BrN3O8S and a molecular weight of 552.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[4-bromobutyl-(2-nitrophenyl)sulfonylamino]propanoyl]oxyamino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[4-bromobutyl-(2-nitrophenyl)sulfonylamino]propanoyl]oxyamino]propanoate |
|---|---|
| PubChem CID | 59537069 |
| Molecular Formula | C20H30BrN3O8S |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[4-bromobutyl-(2-nitrophenyl)sulfonylamino]propanoyl]oxyamino]propanoate |
| SMILES | C[C@H](NOC(=O)[C@H](C)N(CCCCBr)S(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30BrN3O8S/c1-14(18(25)31-20(3,4)5)22-32-19(26)15(2)23(13-9-8-12-21)33(29,30)17-11-7-6-10-16(17)24(27)28/h6-7,10-11,14-15,22H,8-9,12-13H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | VMZSBYXEFVEQQE-GJZGRUSLSA-N |
| XLogP | 2.93 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|