C26H35N3O9S — CID 162411572
ethyl 3-[2-hydroxyethyl-(2-nitrophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate (PubChem CID 162411572) has the molecular formula C26H35N3O9S and a molecular weight of 565.65 g/mol. Its IUPAC name is ethyl 3-[2-hydroxyethyl-(2-nitrophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate.
| Compound Name | ethyl 3-[2-hydroxyethyl-(2-nitrophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 162411572 |
| Molecular Formula | C26H35N3O9S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | ethyl 3-[2-hydroxyethyl-(2-nitrophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
| SMILES | CCOC(=O)CC(C(Cc1ccccc1)NC(=O)OC(C)(C)C)N(CCO)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H35N3O9S/c1-5-37-24(31)18-22(20(17-19-11-7-6-8-12-19)27-25(32)38-26(2,3)4)28(15-16-30)39(35,36)23-14-10-9-13-21(23)29(33)34/h6-14,20,22,30H,5,15-18H2,1-4H3,(H,27,32) |
| InChIKey | CIEHVPCLVIDEEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|