C31H44N6O12S2 — CID 10628911
prop-2-enyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2-nitrophenyl)sulfonylamino]butyl-(2-nitrophenyl)sulfonylamino]propyl]carbamate (PubChem CID 10628911) has the molecular formula C31H44N6O12S2 and a molecular weight of 756.86 g/mol. Its IUPAC name is prop-2-enyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2-nitrophenyl)sulfonylamino]butyl-(2-nitrophenyl)sulfonylamino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2-nitrophenyl)sulfonylamino]butyl-(2-nitrophenyl)sulfonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10628911 |
| Molecular Formula | C31H44N6O12S2 |
| Molecular Weight | 756.86 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | prop-2-enyl N-[3-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2-nitrophenyl)sulfonylamino]butyl-(2-nitrophenyl)sulfonylamino]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCCN(CCCCN(CCCNC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-])S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H44N6O12S2/c1-5-24-48-29(38)32-18-12-22-34(50(44,45)27-16-8-6-14-25(27)36(40)41)20-10-11-21-35(23-13-19-33-30(39)49-31(2,3)4)51(46,47)28-17-9-7-15-26(28)37(42)43/h5-9,14-17H,1,10-13,18-24H2,2-4H3,(H,32,38)(H,33,39) |
| InChIKey | LVIMXMHHLVTOLY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 237.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|