C27H34N4O8S — CID 11599501
tert-butyl N-[(2R)-4-[4-(1,3-dioxoisoindol-2-yl)butyl-(2-nitrophenyl)sulfonylamino]butan-2-yl]carbamate (PubChem CID 11599501) has the molecular formula C27H34N4O8S and a molecular weight of 574.66 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[4-(1,3-dioxoisoindol-2-yl)butyl-(2-nitrophenyl)sulfonylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[4-(1,3-dioxoisoindol-2-yl)butyl-(2-nitrophenyl)sulfonylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11599501 |
| Molecular Formula | C27H34N4O8S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | tert-butyl N-[(2R)-4-[4-(1,3-dioxoisoindol-2-yl)butyl-(2-nitrophenyl)sulfonylamino]butan-2-yl]carbamate |
| SMILES | C[C@H](CCN(CCCCN1C(=O)c2ccccc2C1=O)S(=O)(=O)c1ccccc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N4O8S/c1-19(28-26(34)39-27(2,3)4)15-18-29(40(37,38)23-14-8-7-13-22(23)31(35)36)16-9-10-17-30-24(32)20-11-5-6-12-21(20)25(30)33/h5-8,11-14,19H,9-10,15-18H2,1-4H3,(H,28,34)/t19-/m1/s1 |
| InChIKey | LDVSLDYOXVIJAQ-LJQANCHMSA-N |
| XLogP | 3.97 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|