C20H29N3O8S — CID 58798683
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)sulfonyl-pent-4-enylamino]propanoate (PubChem CID 58798683) has the molecular formula C20H29N3O8S and a molecular weight of 471.53 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)sulfonyl-pent-4-enylamino]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)sulfonyl-pent-4-enylamino]propanoate |
|---|---|
| PubChem CID | 58798683 |
| Molecular Formula | C20H29N3O8S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(2-nitrophenyl)sulfonyl-pent-4-enylamino]propanoate |
| SMILES | C=CCCCN(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29N3O8S/c1-6-7-10-13-22(32(28,29)17-12-9-8-11-16(17)23(26)27)14-15(18(24)30-5)21-19(25)31-20(2,3)4/h6,8-9,11-12,15H,1,7,10,13-14H2,2-5H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | GGABVHBIZZFZFC-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|