C20H30N4O9S — CID 67446060
ethyl 2-[[4-[methyl-(2-nitrophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]amino]acetate (PubChem CID 67446060) has the molecular formula C20H30N4O9S and a molecular weight of 502.55 g/mol. Its IUPAC name is ethyl 2-[[4-[methyl-(2-nitrophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[methyl-(2-nitrophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]amino]acetate |
|---|---|
| PubChem CID | 67446060 |
| Molecular Formula | C20H30N4O9S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | ethyl 2-[[4-[methyl-(2-nitrophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]amino]acetate |
| SMILES | CCOC(=O)CNCC(=O)C(CN(C)S(=O)(=O)c1ccccc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30N4O9S/c1-6-32-18(26)12-21-11-16(25)14(22-19(27)33-20(2,3)4)13-23(5)34(30,31)17-10-8-7-9-15(17)24(28)29/h7-10,14,21H,6,11-13H2,1-5H3,(H,22,27) |
| InChIKey | PCCDTXXOVCRTJB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|