C21H34IN8O8PS — CID 126656964
ethyl 2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-(iodophosphanylamino)methylidene]amino]pentanoyl]amino]-3-[methyl-(2-nitrophenyl)sulfonylamino]propanoyl]-methylamino]acetate (PubChem CID 126656964) has the molecular formula C21H34IN8O8PS and a molecular weight of 716.50 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-(iodophosphanylamino)methylidene]amino]pentanoyl]amino]-3-[methyl-(2-nitrophenyl)sulfonylamino]propanoyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-(iodophosphanylamino)methylidene]amino]pentanoyl]amino]-3-[methyl-(2-nitrophenyl)sulfonylamino]propanoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 126656964 |
| Molecular Formula | C21H34IN8O8PS |
| Molecular Weight | 716.50 g/mol |
| Exact Mass | 716.10 |
| IUPAC Name | ethyl 2-[[(2S)-2-[[(2S)-2-amino-5-[[amino-(iodophosphanylamino)methylidene]amino]pentanoyl]amino]-3-[methyl-(2-nitrophenyl)sulfonylamino]propanoyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)[C@H](CN(C)S(=O)(=O)c1ccccc1[N+](=O)[O-])NC(=O)[C@@H](N)CCC/N=C(\N)NPI |
| InChI | InChI=1S/C21H34IN8O8PS/c1-4-38-18(31)13-28(2)20(33)15(26-19(32)14(23)8-7-11-25-21(24)27-39-22)12-29(3)40(36,37)17-10-6-5-9-16(17)30(34)35/h5-6,9-10,14-15,39H,4,7-8,11-13,23H2,1-3H3,(H,26,32)(H3,24,25,27)/t14-,15-/m0/s1 |
| InChIKey | JFYXEVYGHKGIFJ-GJZGRUSLSA-N |
| XLogP | -0.32 |
| TPSA | 232.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.50 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|