C24H29N7O5S — CID 14283925
methyl 2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-[1-(2-nitrophenyl)sulfanylindol-3-yl]propanoate (PubChem CID 14283925) has the molecular formula C24H29N7O5S and a molecular weight of 527.61 g/mol. Its IUPAC name is methyl 2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-[1-(2-nitrophenyl)sulfanylindol-3-yl]propanoate.
| Compound Name | methyl 2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-[1-(2-nitrophenyl)sulfanylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 14283925 |
| Molecular Formula | C24H29N7O5S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | methyl 2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-[1-(2-nitrophenyl)sulfanylindol-3-yl]propanoate |
| SMILES | COC(=O)C(Cc1cn(Sc2ccccc2[N+](=O)[O-])c2ccccc12)NC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C24H29N7O5S/c1-36-23(33)18(29-22(32)17(25)8-6-12-28-24(26)27)13-15-14-30(19-9-3-2-7-16(15)19)37-21-11-5-4-10-20(21)31(34)35/h2-5,7,9-11,14,17-18H,6,8,12-13,25H2,1H3,(H,29,32)(H4,26,27,28) |
| InChIKey | GQZQAJBNKMLYQV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|