C20H24BrN3O6S — CID 172846274
[(1R)-1-(4-bromophenyl)-2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl] N-tert-butylcarbamate (PubChem CID 172846274) has the molecular formula C20H24BrN3O6S and a molecular weight of 514.40 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)-2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl] N-tert-butylcarbamate.
| Compound Name | [(1R)-1-(4-bromophenyl)-2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 172846274 |
| Molecular Formula | C20H24BrN3O6S |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)-2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl] N-tert-butylcarbamate |
| SMILES | CN(C[C@H](OC(=O)NC(C)(C)C)c1ccc(Br)cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24BrN3O6S/c1-20(2,3)22-19(25)30-17(14-9-11-15(21)12-10-14)13-23(4)31(28,29)18-8-6-5-7-16(18)24(26)27/h5-12,17H,13H2,1-4H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | XLTBPQLRIULYEY-KRWDZBQOSA-N |
| XLogP | 4.24 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|