C22H20Br2N2O5S — CID 171828790
N-[2-(4-bromophenyl)-2-[(4-bromophenyl)methoxy]ethyl]-N-methyl-2-nitrobenzenesulfonamide (PubChem CID 171828790) has the molecular formula C22H20Br2N2O5S and a molecular weight of 584.29 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-[(4-bromophenyl)methoxy]ethyl]-N-methyl-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(4-bromophenyl)-2-[(4-bromophenyl)methoxy]ethyl]-N-methyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 171828790 |
| Molecular Formula | C22H20Br2N2O5S |
| Molecular Weight | 584.29 g/mol |
| Exact Mass | 581.95 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-[(4-bromophenyl)methoxy]ethyl]-N-methyl-2-nitrobenzenesulfonamide |
| SMILES | CN(CC(OCc1ccc(Br)cc1)c1ccc(Br)cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20Br2N2O5S/c1-25(32(29,30)22-5-3-2-4-20(22)26(27)28)14-21(17-8-12-19(24)13-9-17)31-15-16-6-10-18(23)11-7-16/h2-13,21H,14-15H2,1H3 |
| InChIKey | ALVLBROTAGBYMW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.29 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|