C13H17N5O4 — CID 174538612
[2-azido-1-(4-nitrophenyl)ethyl] N-tert-butylcarbamate (PubChem CID 174538612) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is [2-azido-1-(4-nitrophenyl)ethyl] N-tert-butylcarbamate.
| Compound Name | [2-azido-1-(4-nitrophenyl)ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174538612 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [2-azido-1-(4-nitrophenyl)ethyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(CN=[N+]=[N-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17N5O4/c1-13(2,3)16-12(19)22-11(8-15-17-14)9-4-6-10(7-5-9)18(20)21/h4-7,11H,8H2,1-3H3,(H,16,19) |
| InChIKey | VBPJUWSVDHFZGY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|