C13H13Cl2N5O5 — CID 59667652
[(1R,2R)-3-azido-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)propyl] acetate (PubChem CID 59667652) has the molecular formula C13H13Cl2N5O5 and a molecular weight of 390.18 g/mol. Its IUPAC name is [(1R,2R)-3-azido-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)propyl] acetate.
| Compound Name | [(1R,2R)-3-azido-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)propyl] acetate |
|---|---|
| PubChem CID | 59667652 |
| Molecular Formula | C13H13Cl2N5O5 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [(1R,2R)-3-azido-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)propyl] acetate |
| SMILES | CC(=O)O[C@H](c1ccc([N+](=O)[O-])cc1)[C@@H](CN=[N+]=[N-])NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C13H13Cl2N5O5/c1-7(21)25-11(8-2-4-9(5-3-8)20(23)24)10(6-17-19-16)18-13(22)12(14)15/h2-5,10-12H,6H2,1H3,(H,18,22)/t10-,11-/m1/s1 |
| InChIKey | ZYWSAFXZROVEIC-GHMZBOCLSA-N |
| XLogP | 2.80 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|