C13H15N5O5 — CID 90455458
[(1R,2R)-2-acetamido-3-azido-1-(4-nitrophenyl)propyl] acetate (PubChem CID 90455458) has the molecular formula C13H15N5O5 and a molecular weight of 321.29 g/mol. Its IUPAC name is [(1R,2R)-2-acetamido-3-azido-1-(4-nitrophenyl)propyl] acetate.
| Compound Name | [(1R,2R)-2-acetamido-3-azido-1-(4-nitrophenyl)propyl] acetate |
|---|---|
| PubChem CID | 90455458 |
| Molecular Formula | C13H15N5O5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [(1R,2R)-2-acetamido-3-azido-1-(4-nitrophenyl)propyl] acetate |
| SMILES | CC(=O)N[C@H](CN=[N+]=[N-])[C@H](OC(C)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15N5O5/c1-8(19)16-12(7-15-17-14)13(23-9(2)20)10-3-5-11(6-4-10)18(21)22/h3-6,12-13H,7H2,1-2H3,(H,16,19)/t12-,13-/m1/s1 |
| InChIKey | MKYYYYUYHKEGNJ-CHWSQXEVSA-N |
| XLogP | 2.01 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|