C10H11FN4O3 — CID 59154797
1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-nitrobenzene (PubChem CID 59154797) has the molecular formula C10H11FN4O3 and a molecular weight of 254.22 g/mol. Its IUPAC name is 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-nitrobenzene.
| Compound Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 59154797 |
| Molecular Formula | C10H11FN4O3 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-nitrobenzene |
| SMILES | CO[C@H](c1ccc([N+](=O)[O-])cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C10H11FN4O3/c1-18-10(9(6-11)13-14-12)7-2-4-8(5-3-7)15(16)17/h2-5,9-10H,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | DABARWYCLWKVBH-NXEZZACHSA-N |
| XLogP | 2.93 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|