C15H20F2N4O — CID 71066531
(2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine (PubChem CID 71066531) has the molecular formula C15H20F2N4O and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine.
| Compound Name | (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 71066531 |
| Molecular Formula | C15H20F2N4O |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine |
| SMILES | CO[C@H](c1ccc(N2CCC[C@@H]2CF)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C15H20F2N4O/c1-22-15(14(10-17)19-20-18)11-4-6-12(7-5-11)21-8-2-3-13(21)9-16/h4-7,13-15H,2-3,8-10H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | UUPSSQYLNJXVOQ-RBSFLKMASA-N |
| XLogP | 3.96 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|