About (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine
(2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine (PubChem CID 71066531) has the molecular formula C15H20F2N4O
and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine |
| PubChem CID | 71066531 |
| Molecular Formula | C15H20F2N4O |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine |
| SMILES | CO[C@H](c1ccc(N2CCC[C@@H]2CF)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C15H20F2N4O/c1-22-15(14(10-17)19-20-18)11-4-6-12(7-5-11)21-8-2-3-13(21)9-16/h4-7,13-15H,2-3,8-10H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | UUPSSQYLNJXVOQ-RBSFLKMASA-N |
| XLogP | 3.96 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine?
The IUPAC name of (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine (CID 71066531) is (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine.
What is the SMILES notation for (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine?
The canonical SMILES for (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine is CO[C@H](c1ccc(N2CCC[C@@H]2CF)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine?
The InChIKey is UUPSSQYLNJXVOQ-RBSFLKMASA-N. The full InChI is InChI=1S/C15H20F2N4O/c1-22-15(14(10-17)19-20-18)11-4-6-12(7-5-11)21-8-2-3-13(21)9-16/h4-7,13-15H,2-3,8-10H2,1H3/t13-,14-,15-/m1/s1.
What are the key properties of (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine?
(2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine has a molecular weight of 310.35 g/mol, XLogP of 3.96, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-2-(fluoromethyl)pyrrolidine is sourced from PubChem (CID 71066531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).