C16H22FN5O — CID 71066626
1-[[(Z)-2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]but-2-enylidene]amino]ethanamine (PubChem CID 71066626) has the molecular formula C16H22FN5O and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[[(Z)-2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]but-2-enylidene]amino]ethanamine.
| Compound Name | 1-[[(Z)-2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]but-2-enylidene]amino]ethanamine |
|---|---|
| PubChem CID | 71066626 |
| Molecular Formula | C16H22FN5O |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[[(Z)-2-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]but-2-enylidene]amino]ethanamine |
| SMILES | C/C=C(\C=NC(C)N)c1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C16H22FN5O/c1-4-12(10-20-11(2)18)13-5-7-14(8-6-13)16(23-3)15(9-17)21-22-19/h4-8,10-11,15-16H,9,18H2,1-3H3/b12-4+,20-10?/t11?,15-,16-/m1/s1 |
| InChIKey | DGTIENVSTWPTRL-YGGWXNSMSA-N |
| XLogP | 3.80 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|