About 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide
2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide (PubChem CID 59154871) has the molecular formula C13H18FN5O2
and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide |
| PubChem CID | 59154871 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide |
| SMILES | CO[C@H](c1ccc(CNCC(N)=O)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C13H18FN5O2/c1-21-13(11(6-14)18-19-16)10-4-2-9(3-5-10)7-17-8-12(15)20/h2-5,11,13,17H,6-8H2,1H3,(H2,15,20)/t11-,13-/m1/s1 |
| InChIKey | HEVDUBGVKUXAEC-DGCLKSJQSA-N |
| XLogP | 1.60 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide?
The IUPAC name of 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide (CID 59154871) is 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide.
What is the SMILES notation for 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide?
The canonical SMILES for 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide is CO[C@H](c1ccc(CNCC(N)=O)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide?
The InChIKey is HEVDUBGVKUXAEC-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H18FN5O2/c1-21-13(11(6-14)18-19-16)10-4-2-9(3-5-10)7-17-8-12(15)20/h2-5,11,13,17H,6-8H2,1H3,(H2,15,20)/t11-,13-/m1/s1.
What are the key properties of 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide?
2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide has a molecular weight of 295.32 g/mol, XLogP of 1.60, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]methylamino]acetamide is sourced from PubChem (CID 59154871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).