C14H19FN4O3S — CID 59154959
4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 59154959) has the molecular formula C14H19FN4O3S and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 59154959 |
| Molecular Formula | C14H19FN4O3S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CO[C@H](c1ccc(N2CCS(=O)(=O)CC2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H19FN4O3S/c1-22-14(13(10-15)17-18-16)11-2-4-12(5-3-11)19-6-8-23(20,21)9-7-19/h2-5,13-14H,6-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | ULMZYXPOYLNHDN-ZIAGYGMSSA-N |
| XLogP | 2.26 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|