C14H22FN3O — CID 90088114
(1R,2S)-3-fluoro-1-methoxy-1-(4-piperazin-1-ylphenyl)propan-2-amine (PubChem CID 90088114) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is (1R,2S)-3-fluoro-1-methoxy-1-(4-piperazin-1-ylphenyl)propan-2-amine.
| Compound Name | (1R,2S)-3-fluoro-1-methoxy-1-(4-piperazin-1-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 90088114 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (1R,2S)-3-fluoro-1-methoxy-1-(4-piperazin-1-ylphenyl)propan-2-amine |
| SMILES | CO[C@H](c1ccc(N2CCNCC2)cc1)[C@H](N)CF |
| InChI | InChI=1S/C14H22FN3O/c1-19-14(13(16)10-15)11-2-4-12(5-3-11)18-8-6-17-7-9-18/h2-5,13-14,17H,6-10,16H2,1H3/t13-,14-/m1/s1 |
| InChIKey | XYHIDPYEBAAJBQ-ZIAGYGMSSA-N |
| XLogP | 1.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|