C10H15FN2O — CID 134395559
4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]aniline (PubChem CID 134395559) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]aniline.
| Compound Name | 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]aniline |
|---|---|
| PubChem CID | 134395559 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]aniline |
| SMILES | CO[C@H](c1ccc(N)cc1)[C@H](N)CF |
| InChI | InChI=1S/C10H15FN2O/c1-14-10(9(13)6-11)7-2-4-8(12)5-3-7/h2-5,9-10H,6,12-13H2,1H3/t9-,10-/m1/s1 |
| InChIKey | WVIRLWBVRKZSJD-NXEZZACHSA-N |
| XLogP | 1.25 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|