C13H19F2NOS — CID 134395722
(1R,2S)-3-fluoro-1-[4-(3-fluoropropylsulfanyl)phenyl]-1-methoxypropan-2-amine (PubChem CID 134395722) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is (1R,2S)-3-fluoro-1-[4-(3-fluoropropylsulfanyl)phenyl]-1-methoxypropan-2-amine.
| Compound Name | (1R,2S)-3-fluoro-1-[4-(3-fluoropropylsulfanyl)phenyl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 134395722 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (1R,2S)-3-fluoro-1-[4-(3-fluoropropylsulfanyl)phenyl]-1-methoxypropan-2-amine |
| SMILES | CO[C@H](c1ccc(SCCCF)cc1)[C@H](N)CF |
| InChI | InChI=1S/C13H19F2NOS/c1-17-13(12(16)9-15)10-3-5-11(6-4-10)18-8-2-7-14/h3-6,12-13H,2,7-9,16H2,1H3/t12-,13-/m1/s1 |
| InChIKey | ZZLFCSNQLJRRHE-CHWSQXEVSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|