C10H14FNOS — CID 145467283
4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]benzenethiol (PubChem CID 145467283) has the molecular formula C10H14FNOS and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]benzenethiol.
| Compound Name | 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]benzenethiol |
|---|---|
| PubChem CID | 145467283 |
| Molecular Formula | C10H14FNOS |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-[(1R,2S)-2-amino-3-fluoro-1-methoxypropyl]benzenethiol |
| SMILES | CO[C@H](c1ccc(S)cc1)[C@H](N)CF |
| InChI | InChI=1S/C10H14FNOS/c1-13-10(9(12)6-11)7-2-4-8(14)5-3-7/h2-5,9-10,14H,6,12H2,1H3/t9-,10-/m1/s1 |
| InChIKey | AFCWPXWYBDERLN-NXEZZACHSA-N |
| XLogP | 1.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|