C19H25FN4O — CID 142457050
3-fluoro-1-methoxy-1-[4-(6-piperazin-1-yl-3-pyridinyl)phenyl]propan-2-amine (PubChem CID 142457050) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-fluoro-1-methoxy-1-[4-(6-piperazin-1-yl-3-pyridinyl)phenyl]propan-2-amine.
| Compound Name | 3-fluoro-1-methoxy-1-[4-(6-piperazin-1-yl-3-pyridinyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 142457050 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-fluoro-1-methoxy-1-[4-(6-piperazin-1-yl-3-pyridinyl)phenyl]propan-2-amine |
| SMILES | COC(c1ccc(-c2ccc(N3CCNCC3)nc2)cc1)C(N)CF |
| InChI | InChI=1S/C19H25FN4O/c1-25-19(17(21)12-20)15-4-2-14(3-5-15)16-6-7-18(23-13-16)24-10-8-22-9-11-24/h2-7,13,17,19,22H,8-12,21H2,1H3 |
| InChIKey | GRGANJSWMCKVTD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |