C11H16N2O2S2 — CID 167295048
N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]thiohydroxylamine (PubChem CID 167295048) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]thiohydroxylamine.
| Compound Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 167295048 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]thiohydroxylamine |
| SMILES | O=S1(=O)CCN(c2ccc(CNS)cc2)CC1 |
| InChI | InChI=1S/C11H16N2O2S2/c14-17(15)7-5-13(6-8-17)11-3-1-10(2-4-11)9-12-16/h1-4,12,16H,5-9H2 |
| InChIKey | FTRUCVMTLHLPCB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|