C21H28N4O3S — CID 135194069
N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 135194069) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135194069 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-ethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2n(c1C(=O)NCc1ccc(N3CCS(=O)(=O)CC3)cc1)CCCC2 |
| InChI | InChI=1S/C21H28N4O3S/c1-2-18-20(25-10-4-3-5-19(25)23-18)21(26)22-15-16-6-8-17(9-7-16)24-11-13-29(27,28)14-12-24/h6-9H,2-5,10-15H2,1H3,(H,22,26) |
| InChIKey | MXJIHCXDTQNOKQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|