C22H24Cl2N4O — CID 90683102
7-chloro-N-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 90683102) has the molecular formula C22H24Cl2N4O and a molecular weight of 431.37 g/mol. Its IUPAC name is 7-chloro-N-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 7-chloro-N-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90683102 |
| Molecular Formula | C22H24Cl2N4O |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 7-chloro-N-[[4-(4-chloropiperidin-1-yl)phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2cc(Cl)ccn2c1C(=O)NCc1ccc(N2CCC(Cl)CC2)cc1 |
| InChI | InChI=1S/C22H24Cl2N4O/c1-2-19-21(28-12-9-17(24)13-20(28)26-19)22(29)25-14-15-3-5-18(6-4-15)27-10-7-16(23)8-11-27/h3-6,9,12-13,16H,2,7-8,10-11,14H2,1H3,(H,25,29) |
| InChIKey | JZCVJYQDCHFLNK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|