C25H31N5O3 — CID 123431310
ethyl 1-[4-[[(7-amino-2-ethylimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]phenyl]piperidine-4-carboxylate (PubChem CID 123431310) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is ethyl 1-[4-[[(7-amino-2-ethylimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[(7-amino-2-ethylimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 123431310 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | ethyl 1-[4-[[(7-amino-2-ethylimidazo[1,2-a]pyridine-3-carbonyl)amino]methyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(CNC(=O)c3c(CC)nc4cc(N)ccn34)cc2)CC1 |
| InChI | InChI=1S/C25H31N5O3/c1-3-21-23(30-14-11-19(26)15-22(30)28-21)24(31)27-16-17-5-7-20(8-6-17)29-12-9-18(10-13-29)25(32)33-4-2/h5-8,11,14-15,18H,3-4,9-10,12-13,16,26H2,1-2H3,(H,27,31) |
| InChIKey | WETXJMRCMCAIBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|