C29H31ClN4O — CID 90479982
N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethyl-7-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 90479982) has the molecular formula C29H31ClN4O and a molecular weight of 487.05 g/mol. Its IUPAC name is N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethyl-7-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethyl-7-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90479982 |
| Molecular Formula | C29H31ClN4O |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethyl-7-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2cc(C)ccn2c1C(=O)NCc1ccc(N2CCC(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H31ClN4O/c1-3-26-28(34-17-12-20(2)18-27(34)32-26)29(35)31-19-21-4-10-25(11-5-21)33-15-13-23(14-16-33)22-6-8-24(30)9-7-22/h4-12,17-18,23H,3,13-16,19H2,1-2H3,(H,31,35) |
| InChIKey | XVVDBJFHQDLDGH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|